C17H24N4O7 — CID 18207453
ethyl 1-[2-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 18207453) has the molecular formula C17H24N4O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is ethyl 1-[2-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 18207453 |
| Molecular Formula | C17H24N4O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | ethyl 1-[2-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)CC1 |
| InChI | InChI=1S/C17H24N4O7/c1-4-27-17(24)13-5-7-19(8-6-13)14(22)10-28-15(23)9-20-12(3)16(21(25)26)11(2)18-20/h13H,4-10H2,1-3H3 |
| InChIKey | GMYWZTJTBJVORA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 133.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|