C13H15BrN4O3S — CID 27839344
N-[(5-bromothiophen-2-yl)methyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methylacetamide (PubChem CID 27839344) has the molecular formula C13H15BrN4O3S and a molecular weight of 387.26 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methylacetamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 27839344 |
| Molecular Formula | C13H15BrN4O3S |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methylacetamide |
| SMILES | Cc1nn(CC(=O)N(C)Cc2ccc(Br)s2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15BrN4O3S/c1-8-13(18(20)21)9(2)17(15-8)7-12(19)16(3)6-10-4-5-11(14)22-10/h4-5H,6-7H2,1-3H3 |
| InChIKey | LJWFOLAEMKLABX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|