C14H22N4O4 — CID 109400038
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(2-hydroxycyclopentyl)methyl]-N-methylacetamide (PubChem CID 109400038) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(2-hydroxycyclopentyl)methyl]-N-methylacetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(2-hydroxycyclopentyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 109400038 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(2-hydroxycyclopentyl)methyl]-N-methylacetamide |
| SMILES | Cc1nn(CC(=O)N(C)CC2CCCC2O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22N4O4/c1-9-14(18(21)22)10(2)17(15-9)8-13(20)16(3)7-11-5-4-6-12(11)19/h11-12,19H,4-8H2,1-3H3 |
| InChIKey | HVVMHUGTMZHGJN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|