C17H26N4O5S — CID 9453915
N-cyclohexyl-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 9453915) has the molecular formula C17H26N4O5S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-cyclohexyl-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 9453915 |
| Molecular Formula | C17H26N4O5S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-cyclohexyl-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | Cc1nn(CC(=O)N(C2CCCCC2)[C@H]2CCS(=O)(=O)C2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N4O5S/c1-12-17(21(23)24)13(2)19(18-12)10-16(22)20(14-6-4-3-5-7-14)15-8-9-27(25,26)11-15/h14-15H,3-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | URYZPHVOUNTHMD-HNNXBMFYSA-N |
| XLogP | 1.76 |
| TPSA | 115.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|