C15H24N4O5S — CID 40691216
N-[(2R)-butan-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 40691216) has the molecular formula C15H24N4O5S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 40691216 |
| Molecular Formula | C15H24N4O5S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CC[C@@H](C)N(C(=O)Cn1nc(C)c([N+](=O)[O-])c1C)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H24N4O5S/c1-5-10(2)18(13-6-7-25(23,24)9-13)14(20)8-17-12(4)15(19(21)22)11(3)16-17/h10,13H,5-9H2,1-4H3/t10-,13-/m1/s1 |
| InChIKey | HMXPXDWBXYCEJF-ZWNOBZJWSA-N |
| XLogP | 1.22 |
| TPSA | 115.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|