C13H20N4O5 — CID 78877767
methyl 2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]-propan-2-ylamino]acetate (PubChem CID 78877767) has the molecular formula C13H20N4O5 and a molecular weight of 312.33 g/mol. Its IUPAC name is methyl 2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]-propan-2-ylamino]acetate.
| Compound Name | methyl 2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 78877767 |
| Molecular Formula | C13H20N4O5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | methyl 2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]-propan-2-ylamino]acetate |
| SMILES | COC(=O)CN(C(=O)Cn1nc(C)c([N+](=O)[O-])c1C)C(C)C |
| InChI | InChI=1S/C13H20N4O5/c1-8(2)15(7-12(19)22-5)11(18)6-16-10(4)13(17(20)21)9(3)14-16/h8H,6-7H2,1-5H3 |
| InChIKey | KZJYQQTZJMAGKM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|