C13H19N5O6 — CID 4832989
[1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 4832989) has the molecular formula C13H19N5O6 and a molecular weight of 341.32 g/mol. Its IUPAC name is [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 4832989 |
| Molecular Formula | C13H19N5O6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)OC(C(=O)NC(N)=O)C(C)C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N5O6/c1-6(2)11(12(20)15-13(14)21)24-9(19)5-17-8(4)10(18(22)23)7(3)16-17/h6,11H,5H2,1-4H3,(H3,14,15,20,21) |
| InChIKey | UFYXZKFLHPQOCQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|