C15H22N4O2S2 — CID 133395402
5-methyl-N-[2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 133395402) has the molecular formula C15H22N4O2S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 5-methyl-N-[2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133395402 |
| Molecular Formula | C15H22N4O2S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 5-methyl-N-[2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(NCCNS(=O)(=O)c2ccc(C)s2)nc(C(C)C)n1 |
| InChI | InChI=1S/C15H22N4O2S2/c1-10(2)15-18-11(3)9-13(19-15)16-7-8-17-23(20,21)14-6-5-12(4)22-14/h5-6,9-10,17H,7-8H2,1-4H3,(H,16,18,19) |
| InChIKey | HUNARPYFZAMPSN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|