C21H24N6O4S — CID 121032435
N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-3-nitrobenzenesulfonamide (PubChem CID 121032435) has the molecular formula C21H24N6O4S and a molecular weight of 456.53 g/mol. Its IUPAC name is N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121032435 |
| Molecular Formula | C21H24N6O4S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)c1cc(C)nc(Nc2ccc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)n1 |
| InChI | InChI=1S/C21H24N6O4S/c1-4-26(5-2)20-13-15(3)22-21(24-20)23-16-9-11-17(12-10-16)25-32(30,31)19-8-6-7-18(14-19)27(28)29/h6-14,25H,4-5H2,1-3H3,(H,22,23,24) |
| InChIKey | QLYHVVAXURJVHJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|