C21H23N5O3S — CID 122287416
3-acetyl-N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]benzenesulfonamide (PubChem CID 122287416) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-acetyl-N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]benzenesulfonamide.
| Compound Name | 3-acetyl-N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122287416 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-acetyl-N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)Nc2ccc(Nc3nc(C)cc(N(C)C)n3)cc2)c1 |
| InChI | InChI=1S/C21H23N5O3S/c1-14-12-20(26(3)4)24-21(22-14)23-17-8-10-18(11-9-17)25-30(28,29)19-7-5-6-16(13-19)15(2)27/h5-13,25H,1-4H3,(H,22,23,24) |
| InChIKey | SLYPOJKTBHKPFP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |