C21H21FN8O2S — CID 145171436
N-[2-[[4-(4-fluoroanilino)-6-(1,2,4-triazol-4-yl)pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide (PubChem CID 145171436) has the molecular formula C21H21FN8O2S and a molecular weight of 468.52 g/mol. Its IUPAC name is N-[2-[[4-(4-fluoroanilino)-6-(1,2,4-triazol-4-yl)pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[[4-(4-fluoroanilino)-6-(1,2,4-triazol-4-yl)pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 145171436 |
| Molecular Formula | C21H21FN8O2S |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N-[2-[[4-(4-fluoroanilino)-6-(1,2,4-triazol-4-yl)pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNc2nc(Nc3ccc(F)cc3)cc(-n3cnnc3)n2)cc1 |
| InChI | InChI=1S/C21H21FN8O2S/c1-15-2-8-18(9-3-15)33(31,32)26-11-10-23-21-28-19(27-17-6-4-16(22)5-7-17)12-20(29-21)30-13-24-25-14-30/h2-9,12-14,26H,10-11H2,1H3,(H2,23,27,28,29) |
| InChIKey | KINWVFORMSWALP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|