C20H17F3N6O2S — CID 145171478
N-[2-[[4-(4-cyanoanilino)-6-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 145171478) has the molecular formula C20H17F3N6O2S and a molecular weight of 462.46 g/mol. Its IUPAC name is N-[2-[[4-(4-cyanoanilino)-6-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[[4-(4-cyanoanilino)-6-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 145171478 |
| Molecular Formula | C20H17F3N6O2S |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-[2-[[4-(4-cyanoanilino)-6-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(Nc2cc(C(F)(F)F)nc(NCCNS(=O)(=O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H17F3N6O2S/c21-20(22,23)17-12-18(27-15-8-6-14(13-24)7-9-15)29-19(28-17)25-10-11-26-32(30,31)16-4-2-1-3-5-16/h1-9,12,26H,10-11H2,(H2,25,27,28,29) |
| InChIKey | ZDNSDKAILJDXRS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|