C20H26N6O2S — CID 121072620
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2,4,5-trimethylbenzenesulfonamide (PubChem CID 121072620) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2,4,5-trimethylbenzenesulfonamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2,4,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 121072620 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2,4,5-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)n(-c2cc(NCCNS(=O)(=O)c3cc(C)c(C)cc3C)ncn2)n1 |
| InChI | InChI=1S/C20H26N6O2S/c1-13-8-15(3)18(9-14(13)2)29(27,28)24-7-6-21-19-11-20(23-12-22-19)26-17(5)10-16(4)25-26/h8-12,24H,6-7H2,1-5H3,(H,21,22,23) |
| InChIKey | NBHLHIOPCJGTDW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|