C21H30N4O3S — CID 90492572
4-tert-butyl-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]benzenesulfonamide (PubChem CID 90492572) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90492572 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-tert-butyl-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]benzenesulfonamide |
| SMILES | Cc1nc(OCCNS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C21H30N4O3S/c1-16-23-19(25-12-5-6-13-25)15-20(24-16)28-14-11-22-29(26,27)18-9-7-17(8-10-18)21(2,3)4/h7-10,15,22H,5-6,11-14H2,1-4H3 |
| InChIKey | KIIFJKOMFFWKIF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|