C18H21F3N4O4S — CID 90492579
N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 90492579) has the molecular formula C18H21F3N4O4S and a molecular weight of 446.45 g/mol. Its IUPAC name is N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 90492579 |
| Molecular Formula | C18H21F3N4O4S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | Cc1nc(OCCNS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C18H21F3N4O4S/c1-13-23-16(25-9-2-3-10-25)12-17(24-13)28-11-8-22-30(26,27)15-6-4-14(5-7-15)29-18(19,20)21/h4-7,12,22H,2-3,8-11H2,1H3 |
| InChIKey | LKYJFUBBCQOLGY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|