C19H25FN4O3S — CID 90492473
4-fluoro-3-methyl-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzenesulfonamide (PubChem CID 90492473) has the molecular formula C19H25FN4O3S and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90492473 |
| Molecular Formula | C19H25FN4O3S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 4-fluoro-3-methyl-N-[2-(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)oxyethyl]benzenesulfonamide |
| SMILES | Cc1nc(OCCNS(=O)(=O)c2ccc(F)c(C)c2)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C19H25FN4O3S/c1-14-12-16(6-7-17(14)20)28(25,26)21-8-11-27-19-13-18(22-15(2)23-19)24-9-4-3-5-10-24/h6-7,12-13,21H,3-5,8-11H2,1-2H3 |
| InChIKey | HDGKSPLIUJIAPW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|