C14H22BrN2O3S+ — CID 9209536
5-bromo-2-ethoxy-N-(2-pyrrolidin-1-ium-1-ylethyl)benzenesulfonamide (PubChem CID 9209536) has the molecular formula C14H22BrN2O3S+ and a molecular weight of 378.31 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-(2-pyrrolidin-1-ium-1-ylethyl)benzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-(2-pyrrolidin-1-ium-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 9209536 |
| Molecular Formula | C14H22BrN2O3S+ |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 5-bromo-2-ethoxy-N-(2-pyrrolidin-1-ium-1-ylethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NCC[NH+]1CCCC1 |
| InChI | InChI=1S/C14H21BrN2O3S/c1-2-20-13-6-5-12(15)11-14(13)21(18,19)16-7-10-17-8-3-4-9-17/h5-6,11,16H,2-4,7-10H2,1H3/p+1 |
| InChIKey | NLPAOWKONCCPLO-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |