C19H19BrN2O3S — CID 16615074
5-bromo-2-ethoxy-N-(2-quinolin-8-ylethyl)benzenesulfonamide (PubChem CID 16615074) has the molecular formula C19H19BrN2O3S and a molecular weight of 435.34 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-(2-quinolin-8-ylethyl)benzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-(2-quinolin-8-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 16615074 |
| Molecular Formula | C19H19BrN2O3S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 5-bromo-2-ethoxy-N-(2-quinolin-8-ylethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NCCc1cccc2cccnc12 |
| InChI | InChI=1S/C19H19BrN2O3S/c1-2-25-17-9-8-16(20)13-18(17)26(23,24)22-12-10-15-6-3-5-14-7-4-11-21-19(14)15/h3-9,11,13,22H,2,10,12H2,1H3 |
| InChIKey | CPQTXMJLJZDSAS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |