C18H17BrN2O3S — CID 17440973
5-bromo-2-ethoxy-N-(isoquinolin-1-ylmethyl)benzenesulfonamide (PubChem CID 17440973) has the molecular formula C18H17BrN2O3S and a molecular weight of 421.32 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-(isoquinolin-1-ylmethyl)benzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-(isoquinolin-1-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 17440973 |
| Molecular Formula | C18H17BrN2O3S |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 5-bromo-2-ethoxy-N-(isoquinolin-1-ylmethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NCc1nccc2ccccc12 |
| InChI | InChI=1S/C18H17BrN2O3S/c1-2-24-17-8-7-14(19)11-18(17)25(22,23)21-12-16-15-6-4-3-5-13(15)9-10-20-16/h3-11,21H,2,12H2,1H3 |
| InChIKey | QCSAKZHIZHOVHC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |