C16H19BrN2O5S2 — CID 4830347
5-bromo-2-ethoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 4830347) has the molecular formula C16H19BrN2O5S2 and a molecular weight of 463.38 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4830347 |
| Molecular Formula | C16H19BrN2O5S2 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H19BrN2O5S2/c1-2-24-15-8-5-13(17)11-16(15)26(22,23)19-10-9-12-3-6-14(7-4-12)25(18,20)21/h3-8,11,19H,2,9-10H2,1H3,(H2,18,20,21) |
| InChIKey | KCAPAGMKARKMJX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |