C14H15N7O3S — CID 122289273
N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]-1,2-oxazole-4-sulfonamide (PubChem CID 122289273) has the molecular formula C14H15N7O3S and a molecular weight of 361.39 g/mol. Its IUPAC name is N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 122289273 |
| Molecular Formula | C14H15N7O3S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]-1,2-oxazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCNc1ccc(Nc2ccncc2)nn1)c1cnoc1 |
| InChI | InChI=1S/C14H15N7O3S/c22-25(23,12-9-17-24-10-12)18-8-7-16-13-1-2-14(21-20-13)19-11-3-5-15-6-4-11/h1-6,9-10,18H,7-8H2,(H,16,20)(H,15,19,21) |
| InChIKey | YSLSMYUBGUJELQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|