C21H21N7O3S — CID 122289276
4-(2-methyl-1,3-oxazol-4-yl)-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122289276) has the molecular formula C21H21N7O3S and a molecular weight of 451.51 g/mol. Its IUPAC name is 4-(2-methyl-1,3-oxazol-4-yl)-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-(2-methyl-1,3-oxazol-4-yl)-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122289276 |
| Molecular Formula | C21H21N7O3S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 4-(2-methyl-1,3-oxazol-4-yl)-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1nc(-c2ccc(S(=O)(=O)NCCNc3ccc(Nc4ccncc4)nn3)cc2)co1 |
| InChI | InChI=1S/C21H21N7O3S/c1-15-25-19(14-31-15)16-2-4-18(5-3-16)32(29,30)24-13-12-23-20-6-7-21(28-27-20)26-17-8-10-22-11-9-17/h2-11,14,24H,12-13H2,1H3,(H,23,27)(H,22,26,28) |
| InChIKey | NUHPJXCWIDPFSJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|