C16H20N2O4S — CID 56805930
4-(2-methyl-1,3-oxazol-4-yl)-N-(oxan-2-ylmethyl)benzenesulfonamide (PubChem CID 56805930) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 4-(2-methyl-1,3-oxazol-4-yl)-N-(oxan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(2-methyl-1,3-oxazol-4-yl)-N-(oxan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 56805930 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-(2-methyl-1,3-oxazol-4-yl)-N-(oxan-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1nc(-c2ccc(S(=O)(=O)NCC3CCCCO3)cc2)co1 |
| InChI | InChI=1S/C16H20N2O4S/c1-12-18-16(11-22-12)13-5-7-15(8-6-13)23(19,20)17-10-14-4-2-3-9-21-14/h5-8,11,14,17H,2-4,9-10H2,1H3 |
| InChIKey | BVXUAIQLOIDETP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |