C15H17NO4S — CID 168527242
4-(furan-2-yl)-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 168527242) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(furan-2-yl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 168527242 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-(furan-2-yl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCO1)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C15H17NO4S/c17-21(18,16-11-13-3-1-9-19-13)14-7-5-12(6-8-14)15-4-2-10-20-15/h2,4-8,10,13,16H,1,3,9,11H2 |
| InChIKey | UWLAWIOUEDRAAL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |