C12H18N6O3S — CID 122324772
N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1,2-oxazole-4-sulfonamide (PubChem CID 122324772) has the molecular formula C12H18N6O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 122324772 |
| Molecular Formula | C12H18N6O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1,2-oxazole-4-sulfonamide |
| SMILES | CCNc1cc(C)nc(NCCNS(=O)(=O)c2cnoc2)n1 |
| InChI | InChI=1S/C12H18N6O3S/c1-3-13-11-6-9(2)17-12(18-11)14-4-5-16-22(19,20)10-7-15-21-8-10/h6-8,16H,3-5H2,1-2H3,(H2,13,14,17,18) |
| InChIKey | ODCZOPUMRMVJOC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|