C17H20N8O3S2 — CID 122327041
N-[5-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethylsulfamoyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 122327041) has the molecular formula C17H20N8O3S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[5-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethylsulfamoyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethylsulfamoyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 122327041 |
| Molecular Formula | C17H20N8O3S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[5-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethylsulfamoyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(S(=O)(=O)NCCNc2ccc(Nc3ccc(C)cn3)nn2)s1 |
| InChI | InChI=1S/C17H20N8O3S2/c1-11-3-4-13(19-9-11)23-15-6-5-14(24-25-15)18-7-8-21-30(27,28)16-10-20-17(29-16)22-12(2)26/h3-6,9-10,21H,7-8H2,1-2H3,(H,18,24)(H,19,23,25)(H,20,22,26) |
| InChIKey | BRHDIBJSHLSGJH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 150.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|