C17H24FN5O3S — CID 122293499
4-ethoxy-N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-fluorobenzenesulfonamide (PubChem CID 122293499) has the molecular formula C17H24FN5O3S and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-fluorobenzenesulfonamide.
| Compound Name | 4-ethoxy-N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 122293499 |
| Molecular Formula | C17H24FN5O3S |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-ethoxy-N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-fluorobenzenesulfonamide |
| SMILES | CCNc1cc(NCCNS(=O)(=O)c2ccc(OCC)c(F)c2)nc(C)n1 |
| InChI | InChI=1S/C17H24FN5O3S/c1-4-19-16-11-17(23-12(3)22-16)20-8-9-21-27(24,25)13-6-7-15(26-5-2)14(18)10-13/h6-7,10-11,21H,4-5,8-9H2,1-3H3,(H2,19,20,22,23) |
| InChIKey | XGUWAHFHKOIEKT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|