C15H22BrNO3 — CID 2071413
3-(2-bromo-4,5-dimethoxyphenyl)-N-butylpropanamide (PubChem CID 2071413) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is 3-(2-bromo-4,5-dimethoxyphenyl)-N-butylpropanamide.
| Compound Name | 3-(2-bromo-4,5-dimethoxyphenyl)-N-butylpropanamide |
|---|---|
| PubChem CID | 2071413 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 3-(2-bromo-4,5-dimethoxyphenyl)-N-butylpropanamide |
| SMILES | CCCCNC(=O)CCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C15H22BrNO3/c1-4-5-8-17-15(18)7-6-11-9-13(19-2)14(20-3)10-12(11)16/h9-10H,4-8H2,1-3H3,(H,17,18) |
| InChIKey | FBKLESYFZSHJFB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|