C22H28BrNO5 — CID 24506331
N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-4-(2-ethoxyphenoxy)butanamide (PubChem CID 24506331) has the molecular formula C22H28BrNO5 and a molecular weight of 466.37 g/mol. Its IUPAC name is N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-4-(2-ethoxyphenoxy)butanamide.
| Compound Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-4-(2-ethoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 24506331 |
| Molecular Formula | C22H28BrNO5 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-4-(2-ethoxyphenoxy)butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)NCCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C22H28BrNO5/c1-4-28-18-8-5-6-9-19(18)29-13-7-10-22(25)24-12-11-16-14-20(26-2)21(27-3)15-17(16)23/h5-6,8-9,14-15H,4,7,10-13H2,1-3H3,(H,24,25) |
| InChIKey | FFBNSIACSPDILD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|