C20H18N2O3 — CID 60555760
3-methoxy-4-prop-2-enoxy-N-quinolin-6-ylbenzamide (PubChem CID 60555760) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-methoxy-4-prop-2-enoxy-N-quinolin-6-ylbenzamide.
| Compound Name | 3-methoxy-4-prop-2-enoxy-N-quinolin-6-ylbenzamide |
|---|---|
| PubChem CID | 60555760 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-methoxy-4-prop-2-enoxy-N-quinolin-6-ylbenzamide |
| SMILES | C=CCOc1ccc(C(=O)Nc2ccc3ncccc3c2)cc1OC |
| InChI | InChI=1S/C20H18N2O3/c1-3-11-25-18-9-6-15(13-19(18)24-2)20(23)22-16-7-8-17-14(12-16)5-4-10-21-17/h3-10,12-13H,1,11H2,2H3,(H,22,23) |
| InChIKey | ILSWPMSSKCJLHQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|