C13H16N4O2S — CID 119956149
2-amino-N-[2-(1,3-benzothiazol-2-yl)ethyl]butanediamide (PubChem CID 119956149) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-amino-N-[2-(1,3-benzothiazol-2-yl)ethyl]butanediamide.
| Compound Name | 2-amino-N-[2-(1,3-benzothiazol-2-yl)ethyl]butanediamide |
|---|---|
| PubChem CID | 119956149 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-amino-N-[2-(1,3-benzothiazol-2-yl)ethyl]butanediamide |
| SMILES | NC(=O)CC(N)C(=O)NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H16N4O2S/c14-8(7-11(15)18)13(19)16-6-5-12-17-9-3-1-2-4-10(9)20-12/h1-4,8H,5-7,14H2,(H2,15,18)(H,16,19) |
| InChIKey | QOFNAWWHEJMPHX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |