C9H16N2S — CID 61330921
N,2-dimethyl-1-(1,3-thiazol-2-yl)butan-1-amine (PubChem CID 61330921) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is N,2-dimethyl-1-(1,3-thiazol-2-yl)butan-1-amine.
| Compound Name | N,2-dimethyl-1-(1,3-thiazol-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 61330921 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N,2-dimethyl-1-(1,3-thiazol-2-yl)butan-1-amine |
| SMILES | CCC(C)C(NC)c1nccs1 |
| InChI | InChI=1S/C9H16N2S/c1-4-7(2)8(10-3)9-11-5-6-12-9/h5-8,10H,4H2,1-3H3 |
| InChIKey | FNLDRANEQVQSDG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |