C11H19N3OS — CID 104584894
N-methyl-3-[2-(1,3-thiazol-2-yl)propylamino]butanamide (PubChem CID 104584894) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is N-methyl-3-[2-(1,3-thiazol-2-yl)propylamino]butanamide.
| Compound Name | N-methyl-3-[2-(1,3-thiazol-2-yl)propylamino]butanamide |
|---|---|
| PubChem CID | 104584894 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-methyl-3-[2-(1,3-thiazol-2-yl)propylamino]butanamide |
| SMILES | CNC(=O)CC(C)NCC(C)c1nccs1 |
| InChI | InChI=1S/C11H19N3OS/c1-8(11-13-4-5-16-11)7-14-9(2)6-10(15)12-3/h4-5,8-9,14H,6-7H2,1-3H3,(H,12,15) |
| InChIKey | OOCJSRQLORBGKJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |