C15H23NO4S — CID 103972814
diethyl 2-(2-methylpropyl)-2-(1,3-thiazol-2-ylmethyl)propanedioate (PubChem CID 103972814) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is diethyl 2-(2-methylpropyl)-2-(1,3-thiazol-2-ylmethyl)propanedioate.
| Compound Name | diethyl 2-(2-methylpropyl)-2-(1,3-thiazol-2-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 103972814 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | diethyl 2-(2-methylpropyl)-2-(1,3-thiazol-2-ylmethyl)propanedioate |
| SMILES | CCOC(=O)C(Cc1nccs1)(CC(C)C)C(=O)OCC |
| InChI | InChI=1S/C15H23NO4S/c1-5-19-13(17)15(9-11(3)4,14(18)20-6-2)10-12-16-7-8-21-12/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | PCEFFWICTQPYST-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|