C14H19BrO4S — CID 103974028
2-[(3-bromothiophen-2-yl)methyl]-2-ethoxycarbonyl-4-methylpentanoic acid (PubChem CID 103974028) has the molecular formula C14H19BrO4S and a molecular weight of 363.27 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)methyl]-2-ethoxycarbonyl-4-methylpentanoic acid.
| Compound Name | 2-[(3-bromothiophen-2-yl)methyl]-2-ethoxycarbonyl-4-methylpentanoic acid |
|---|---|
| PubChem CID | 103974028 |
| Molecular Formula | C14H19BrO4S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)methyl]-2-ethoxycarbonyl-4-methylpentanoic acid |
| SMILES | CCOC(=O)C(Cc1sccc1Br)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C14H19BrO4S/c1-4-19-13(18)14(12(16)17,7-9(2)3)8-11-10(15)5-6-20-11/h5-6,9H,4,7-8H2,1-3H3,(H,16,17) |
| InChIKey | JNTIBIQTBGSGEK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|