About ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride
ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride (PubChem CID 120898778) has the molecular formula C12H22ClN3O2S
and a molecular weight of 307.85 g/mol. Its IUPAC name is ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride |
| PubChem CID | 120898778 |
| Molecular Formula | C12H22ClN3O2S |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride |
| SMILES | CCOC(=O)CN(Cc1cnc(N)s1)CC(C)C.Cl |
| InChI | InChI=1S/C12H21N3O2S.ClH/c1-4-17-11(16)8-15(6-9(2)3)7-10-5-14-12(13)18-10;/h5,9H,4,6-8H2,1-3H3,(H2,13,14);1H |
| InChIKey | PPEDZIOPWSGVFH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride?
The IUPAC name of ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride (CID 120898778) is ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride.
What is the SMILES notation for ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride?
The canonical SMILES for ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride is CCOC(=O)CN(Cc1cnc(N)s1)CC(C)C.Cl.
What is the InChIKey of ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride?
The InChIKey is PPEDZIOPWSGVFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2S.ClH/c1-4-17-11(16)8-15(6-9(2)3)7-10-5-14-12(13)18-10;/h5,9H,4,6-8H2,1-3H3,(H2,13,14);1H.
What are the key properties of ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride?
ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride has a molecular weight of 307.85 g/mol, XLogP of 2.17, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2-methylpropyl)amino]acetate;hydrochloride is sourced from PubChem (CID 120898778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).