C17H14O4 — CID 24582197
4-(1,3-benzodioxol-5-ylmethoxy)-2,3-dihydroinden-1-one (PubChem CID 24582197) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethoxy)-2,3-dihydroinden-1-one.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 24582197 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethoxy)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2c(OCc3ccc4c(c3)OCO4)cccc21 |
| InChI | InChI=1S/C17H14O4/c18-14-6-5-13-12(14)2-1-3-15(13)19-9-11-4-7-16-17(8-11)21-10-20-16/h1-4,7-8H,5-6,9-10H2 |
| InChIKey | DGPONZRZIMVIKI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |