C21H24O5 — CID 139921861
7-[2-(1,3-benzodioxol-5-ylmethoxy)phenyl]heptanoic acid (PubChem CID 139921861) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 7-[2-(1,3-benzodioxol-5-ylmethoxy)phenyl]heptanoic acid.
| Compound Name | 7-[2-(1,3-benzodioxol-5-ylmethoxy)phenyl]heptanoic acid |
|---|---|
| PubChem CID | 139921861 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 7-[2-(1,3-benzodioxol-5-ylmethoxy)phenyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCc1ccccc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H24O5/c22-21(23)10-4-2-1-3-7-17-8-5-6-9-18(17)24-14-16-11-12-19-20(13-16)26-15-25-19/h5-6,8-9,11-13H,1-4,7,10,14-15H2,(H,22,23) |
| InChIKey | WSKYNQSZUXRIBD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|