C13H12BNO5 — CID 118734752
[6-(1,3-benzodioxol-5-ylmethoxy)-3-pyridinyl]boronic acid (PubChem CID 118734752) has the molecular formula C13H12BNO5 and a molecular weight of 273.05 g/mol. Its IUPAC name is [6-(1,3-benzodioxol-5-ylmethoxy)-3-pyridinyl]boronic acid.
| Compound Name | [6-(1,3-benzodioxol-5-ylmethoxy)-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 118734752 |
| Molecular Formula | C13H12BNO5 |
| Molecular Weight | 273.05 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | [6-(1,3-benzodioxol-5-ylmethoxy)-3-pyridinyl]boronic acid |
| SMILES | OB(O)c1ccc(OCc2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C13H12BNO5/c16-14(17)10-2-4-13(15-6-10)18-7-9-1-3-11-12(5-9)20-8-19-11/h1-6,16-17H,7-8H2 |
| InChIKey | FFCYPWDUGZZQTH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.05 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|