C17H18O6S — CID 134849095
2-(1,3-benzodioxol-5-yl)-1-(4-methoxyphenyl)sulfonylpropan-2-ol (PubChem CID 134849095) has the molecular formula C17H18O6S and a molecular weight of 350.39 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-(4-methoxyphenyl)sulfonylpropan-2-ol.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-(4-methoxyphenyl)sulfonylpropan-2-ol |
|---|---|
| PubChem CID | 134849095 |
| Molecular Formula | C17H18O6S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-(4-methoxyphenyl)sulfonylpropan-2-ol |
| SMILES | COc1ccc(S(=O)(=O)CC(C)(O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H18O6S/c1-17(18,12-3-8-15-16(9-12)23-11-22-15)10-24(19,20)14-6-4-13(21-2)5-7-14/h3-9,18H,10-11H2,1-2H3 |
| InChIKey | JVEICMJSNIIVHE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |