C19H18O5S — CID 23047837
5-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonylpent-4-ynoic acid (PubChem CID 23047837) has the molecular formula C19H18O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonylpent-4-ynoic acid.
| Compound Name | 5-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonylpent-4-ynoic acid |
|---|---|
| PubChem CID | 23047837 |
| Molecular Formula | C19H18O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonylpent-4-ynoic acid |
| SMILES | COc1ccc(C#CCC(C(=O)O)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H18O5S/c1-14-6-12-17(13-7-14)25(22,23)18(19(20)21)5-3-4-15-8-10-16(24-2)11-9-15/h6-13,18H,5H2,1-2H3,(H,20,21) |
| InChIKey | QZIOEKPQJACAMT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|