C19H19ClNO6S+ — CID 20610881
[(1S)-1-carboxyethyl]-[3-(4-chlorophenyl)prop-2-ynyl]-hydroxy-(4-methoxyphenyl)sulfonylazanium (PubChem CID 20610881) has the molecular formula C19H19ClNO6S+ and a molecular weight of 424.88 g/mol. Its IUPAC name is [(1S)-1-carboxyethyl]-[3-(4-chlorophenyl)prop-2-ynyl]-hydroxy-(4-methoxyphenyl)sulfonylazanium.
| Compound Name | [(1S)-1-carboxyethyl]-[3-(4-chlorophenyl)prop-2-ynyl]-hydroxy-(4-methoxyphenyl)sulfonylazanium |
|---|---|
| PubChem CID | 20610881 |
| Molecular Formula | C19H19ClNO6S+ |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | [(1S)-1-carboxyethyl]-[3-(4-chlorophenyl)prop-2-ynyl]-hydroxy-(4-methoxyphenyl)sulfonylazanium |
| SMILES | COc1ccc(S(=O)(=O)[N+](O)(CC#Cc2ccc(Cl)cc2)[C@@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C19H18ClNO6S/c1-14(19(22)23)21(24,13-3-4-15-5-7-16(20)8-6-15)28(25,26)18-11-9-17(27-2)10-12-18/h5-12,14,24H,13H2,1-2H3/p+1/t14-,21?/m0/s1 |
| InChIKey | DRSRJDQFWMJIRA-YXWRBFHGSA-O |
| XLogP | 2.77 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|