C22H25NO4S — CID 177461493
N-[4-(4-methoxyphenyl)but-3-ynyl]-4-methyl-N-(2-methyl-3-oxopropyl)benzenesulfonamide (PubChem CID 177461493) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)but-3-ynyl]-4-methyl-N-(2-methyl-3-oxopropyl)benzenesulfonamide.
| Compound Name | N-[4-(4-methoxyphenyl)but-3-ynyl]-4-methyl-N-(2-methyl-3-oxopropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177461493 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-[4-(4-methoxyphenyl)but-3-ynyl]-4-methyl-N-(2-methyl-3-oxopropyl)benzenesulfonamide |
| SMILES | COc1ccc(C#CCCN(CC(C)C=O)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-18-7-13-22(14-8-18)28(25,26)23(16-19(2)17-24)15-5-4-6-20-9-11-21(27-3)12-10-20/h7-14,17,19H,5,15-16H2,1-3H3 |
| InChIKey | ZETODMDGJUERCL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|