C31H40N2O4S2 — CID 18786188
4-benzylsulfanyl-N-[(2-methylpropan-2-yl)oxy]-2-[2-methylpropyl-(4-phenylphenyl)sulfonylamino]butanamide (PubChem CID 18786188) has the molecular formula C31H40N2O4S2 and a molecular weight of 568.81 g/mol. Its IUPAC name is 4-benzylsulfanyl-N-[(2-methylpropan-2-yl)oxy]-2-[2-methylpropyl-(4-phenylphenyl)sulfonylamino]butanamide.
| Compound Name | 4-benzylsulfanyl-N-[(2-methylpropan-2-yl)oxy]-2-[2-methylpropyl-(4-phenylphenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 18786188 |
| Molecular Formula | C31H40N2O4S2 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 4-benzylsulfanyl-N-[(2-methylpropan-2-yl)oxy]-2-[2-methylpropyl-(4-phenylphenyl)sulfonylamino]butanamide |
| SMILES | CC(C)CN(C(CCSCc1ccccc1)C(=O)NOC(C)(C)C)S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H40N2O4S2/c1-24(2)22-33(39(35,36)28-18-16-27(17-19-28)26-14-10-7-11-15-26)29(30(34)32-37-31(3,4)5)20-21-38-23-25-12-8-6-9-13-25/h6-19,24,29H,20-23H2,1-5H3,(H,32,34) |
| InChIKey | VIYPWXNLUFSILZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|