C29H32N2O4S — CID 59746212
(2R)-3-benzylsulfanyl-2-[[3-methylbutyl-(4-phenylbenzoyl)carbamoyl]amino]propanoic acid (PubChem CID 59746212) has the molecular formula C29H32N2O4S and a molecular weight of 504.65 g/mol. Its IUPAC name is (2R)-3-benzylsulfanyl-2-[[3-methylbutyl-(4-phenylbenzoyl)carbamoyl]amino]propanoic acid.
| Compound Name | (2R)-3-benzylsulfanyl-2-[[3-methylbutyl-(4-phenylbenzoyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59746212 |
| Molecular Formula | C29H32N2O4S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (2R)-3-benzylsulfanyl-2-[[3-methylbutyl-(4-phenylbenzoyl)carbamoyl]amino]propanoic acid |
| SMILES | CC(C)CCN(C(=O)N[C@@H](CSCc1ccccc1)C(=O)O)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N2O4S/c1-21(2)17-18-31(27(32)25-15-13-24(14-16-25)23-11-7-4-8-12-23)29(35)30-26(28(33)34)20-36-19-22-9-5-3-6-10-22/h3-16,21,26H,17-20H2,1-2H3,(H,30,35)(H,33,34)/t26-/m0/s1 |
| InChIKey | GESYRSDNOUOQRI-SANMLTNESA-N |
| XLogP | 5.94 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |