C27H32N2O4S — CID 59746208
(2R)-3-(3-methylbutylsulfanyl)-2-[[[3-(2-phenylethynyl)benzoyl]-propylcarbamoyl]amino]propanoic acid (PubChem CID 59746208) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is (2R)-3-(3-methylbutylsulfanyl)-2-[[[3-(2-phenylethynyl)benzoyl]-propylcarbamoyl]amino]propanoic acid.
| Compound Name | (2R)-3-(3-methylbutylsulfanyl)-2-[[[3-(2-phenylethynyl)benzoyl]-propylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59746208 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (2R)-3-(3-methylbutylsulfanyl)-2-[[[3-(2-phenylethynyl)benzoyl]-propylcarbamoyl]amino]propanoic acid |
| SMILES | CCCN(C(=O)N[C@@H](CSCCC(C)C)C(=O)O)C(=O)c1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H32N2O4S/c1-4-16-29(27(33)28-24(26(31)32)19-34-17-15-20(2)3)25(30)23-12-8-11-22(18-23)14-13-21-9-6-5-7-10-21/h5-12,18,20,24H,4,15-17,19H2,1-3H3,(H,28,33)(H,31,32)/t24-/m0/s1 |
| InChIKey | SEGIMPGSKGIMLJ-DEOSSOPVSA-N |
| XLogP | 4.88 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|