C29H30N2O4S — CID 90860279
(2R)-3-benzylsulfanyl-2-[[[3-(2-phenylethenyl)benzoyl]-propylcarbamoyl]amino]propanoic acid (PubChem CID 90860279) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is (2R)-3-benzylsulfanyl-2-[[[3-(2-phenylethenyl)benzoyl]-propylcarbamoyl]amino]propanoic acid.
| Compound Name | (2R)-3-benzylsulfanyl-2-[[[3-(2-phenylethenyl)benzoyl]-propylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 90860279 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (2R)-3-benzylsulfanyl-2-[[[3-(2-phenylethenyl)benzoyl]-propylcarbamoyl]amino]propanoic acid |
| SMILES | CCCN(C(=O)N[C@@H](CSCc1ccccc1)C(=O)O)C(=O)c1cccc(C=Cc2ccccc2)c1 |
| InChI | InChI=1S/C29H30N2O4S/c1-2-18-31(29(35)30-26(28(33)34)21-36-20-24-12-7-4-8-13-24)27(32)25-15-9-14-23(19-25)17-16-22-10-5-3-6-11-22/h3-17,19,26H,2,18,20-21H2,1H3,(H,30,35)(H,33,34)/t26-/m0/s1 |
| InChIKey | DOXVPTYVEFCJNJ-SANMLTNESA-N |
| XLogP | 5.81 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|