C25H30N2O3S — CID 123646049
N-[(2R)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-pyridin-4-ylbenzenesulfonamide (PubChem CID 123646049) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-pyridin-4-ylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-pyridin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 123646049 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-[(2R)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-pyridin-4-ylbenzenesulfonamide |
| SMILES | CC(C)CN(C[C@H](O)CCc1ccccc1)S(=O)(=O)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C25H30N2O3S/c1-20(2)18-27(19-24(28)11-8-21-6-4-3-5-7-21)31(29,30)25-12-9-22(10-13-25)23-14-16-26-17-15-23/h3-7,9-10,12-17,20,24,28H,8,11,18-19H2,1-2H3/t24-/m1/s1 |
| InChIKey | BRVVLTPGYWBWNB-XMMPIXPASA-N |
| XLogP | 4.39 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |