C23H30N2O4S — CID 90760193
3-(aminomethyl)-N-(2-hydroxy-4-phenylbutyl)-N-(2-methylpropyl)-1-benzofuran-5-sulfonamide (PubChem CID 90760193) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-hydroxy-4-phenylbutyl)-N-(2-methylpropyl)-1-benzofuran-5-sulfonamide.
| Compound Name | 3-(aminomethyl)-N-(2-hydroxy-4-phenylbutyl)-N-(2-methylpropyl)-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 90760193 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 3-(aminomethyl)-N-(2-hydroxy-4-phenylbutyl)-N-(2-methylpropyl)-1-benzofuran-5-sulfonamide |
| SMILES | CC(C)CN(CC(O)CCc1ccccc1)S(=O)(=O)c1ccc2occ(CN)c2c1 |
| InChI | InChI=1S/C23H30N2O4S/c1-17(2)14-25(15-20(26)9-8-18-6-4-3-5-7-18)30(27,28)21-10-11-23-22(12-21)19(13-24)16-29-23/h3-7,10-12,16-17,20,26H,8-9,13-15,24H2,1-2H3 |
| InChIKey | UJADMVHKEDWTKC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |