C28H39N3O6S — CID 59608494
tert-butyl N-[(2S,3R)-4-[[3-(aminomethyl)-1-benzofuran-5-yl]sulfonyl-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59608494) has the molecular formula C28H39N3O6S and a molecular weight of 554.76 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-4-[[3-(aminomethyl)-1-benzofuran-5-yl]sulfonyl-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-4-[[3-(aminomethyl)-1-benzofuran-5-yl]sulfonyl-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59608494 |
| Molecular Formula | C28H39N3O6S |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | tert-butyl N-[(2S,3R)-4-[[3-(aminomethyl)-1-benzofuran-5-yl]sulfonyl-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])N(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)S(=O)(=O)c1ccc2occ(CN)c2c1 |
| InChI | InChI=1S/C28H39N3O6S/c1-19(2)16-31(38(34,35)22-11-12-26-23(14-22)21(15-29)18-36-26)17-25(32)24(13-20-9-7-6-8-10-20)30-27(33)37-28(3,4)5/h6-12,14,18-19,24-25,32H,13,15-17,29H2,1-5H3,(H,30,33)/t24-,25+/m0/s1/i1D3,2D3,16D2,19D |
| InChIKey | HNVNEYDFWQJMID-KESKTDRZSA-N |
| XLogP | 4.04 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |